Bis(2,2,2-trifluoro-N-phenylethanehydrazonoyl) disulfide structure
|
Common Name | Bis(2,2,2-trifluoro-N-phenylethanehydrazonoyl) disulfide | ||
|---|---|---|---|---|
| CAS Number | 4454-60-8 | Molecular Weight | 438.41400 | |
| Density | 1.41g/cm3 | Boiling Point | 409.9ºC at 760 mmHg | |
| Molecular Formula | C16H12F6N4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.7ºC | |
| Name | [(Z)-N-anilino-C-(trifluoromethyl)carbonimidoyl]sulfanyl (1Z)-N-anilino-2,2,2-trifluoroethanimidothioate |
|---|
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 409.9ºC at 760 mmHg |
| Molecular Formula | C16H12F6N4S2 |
| Molecular Weight | 438.41400 |
| Flash Point | 201.7ºC |
| Exact Mass | 438.04100 |
| PSA | 99.38000 |
| LogP | 6.48960 |
| Index of Refraction | 1.555 |
| InChIKey | CEQMAWQVGGCLCK-WFBNZKAHSA-N |
| SMILES | FC(F)(F)C(=NNc1ccccc1)SSC(=NNc1ccccc1)C(F)(F)F |
| HS Code | 2930909090 |
|---|
|
~%
Bis(2,2,2-trifl... CAS#:4454-60-8 |
| Literature: Brown,H.C.; Pater,R. Journal of Organic Chemistry, 1965 , vol. 30, p. 3739 - 3746 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |