1-[2-(2,3-dihydro-1H-indol-1-yl)-2-oxoethyl]-1H-indole-3-carbonitrile
Modify Date: 2026-06-16 12:19:02
![1-[2-(2,3-dihydro-1H-indol-1-yl)-2-oxoethyl]-1H-indole-3-carbonitrile Structure](https://www.chemsrc.com/extcaspic/374/445416-23-9.png)
1-[2-(2,3-dihydro-1H-indol-1-yl)-2-oxoethyl]-1H-indole-3-carbonitrile structure
|
Common Name | 1-[2-(2,3-dihydro-1H-indol-1-yl)-2-oxoethyl]-1H-indole-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 445416-23-9 | Molecular Weight | 301.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[2-(2,3-dihydro-1H-indol-1-yl)-2-oxoethyl]-1H-indole-3-carbonitrile |
|---|
| Molecular Formula | C19H15N3O |
|---|---|
| Molecular Weight | 301.3 |
| InChIKey | HYFWADVHPXZTKV-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)C(=O)CN3C=C(C4=CC=CC=C43)C#N |
|
Name: USP8 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 8
External Id: USP8 FAST DUB HTS Primary
|
|
Name: Discovery of Small Molecules to Inhibit Human Cytomegalovirus Nuclear Egress
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: HCMV UL50
External Id: HMS1262
|
|
Name: USP17 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 17 like family member 5
External Id: USP17 FAST DUB HTS Primary
|
|
Name: USP7 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 7
External Id: USP7 FAST DUB HTS Primary
|
|
Name: A screen for compounds that inhibit the activity of LtaS in Staphylococcus aureus
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
External Id: HMS979
|
|
Name: A screen for compounds that inhibit viral RNA polymerase binding and polymerization a...
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: Chain A, Poliovirus Polymerase With Gtp
External Id: HMS750
|
|
Name: USP30 deubiquitinase inhibition: Dose-response Confirmation
Source: 24642
Target: ubiquitin specific peptidase 30
External Id: USP30 FAST DUB HTS Confirmation
|
|
Name: USP17 deubiquitinase inhibition: Dose-response Confirmation
Source: 24642
Target: ubiquitin specific peptidase 17 like family member 5
External Id: USP17 FAST DUB HTS Confirmation
|
|
Name: USP28 deubiquitinase inhibition: Dose-response Confirmation
Source: 24642
Target: ubiquitin specific peptidase 28
External Id: USP28 FAST DUB HTS Confirmation
|
|
Name: OTUD3 deubiquitinase inhibition: Dose-response Confirmation
Source: 24642
Target: OTU deubiquitinase 3
External Id: OTUD3 FAST DUB HTS Confirmation
|
Total 15, Current Page 1 of 2
1
2