Ochrocarpinone A
Modify Date: 2026-06-27 11:42:49
Ochrocarpinone A structure
|
Common Name | Ochrocarpinone A | ||
|---|---|---|---|---|
| CAS Number | 445461-89-2 | Molecular Weight | 534.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H42O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ochrocarpinone A |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C33H42O6 |
|---|---|
| Molecular Weight | 534.7 |
| InChIKey | LCJOSIBQVUSWIH-UHFFFAOYSA-N |
| SMILES | CC(=CCC1CC2(C3=C(CC(C(O3)(C)C)OO)C(=O)C(C2=O)(C1(C)C)C(=O)C4=CC=CC=C4)CC=C(C)C)C |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Cytotoxicity against human A2780 cells
Source: ChEMBL
Target: A2780
External Id: CHEMBL1008078
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Ochrocarpinone A? |
| A: CAS number of Ochrocarpinone A is 445461-89-2. |
| Q: What is the SMILES notation of Ochrocarpinone A? |
| A: SMILES notation of Ochrocarpinone A is CC(=CCC1CC2(C3=C(CC(C(O3)(C)C)OO)C(=O)C(C2=O)(C1(C)C)C(=O)C4=CC=CC=C4)CC=C(C)C)C. |
| Q: What is the Chinese name of 445461-89-2? |
| A: Chinese name of 445461-89-2 is 445461-89-2. |
| Q: What is the English name of Ochrocarpinone A? |
| A: The English name of Ochrocarpinone A is Ochrocarpinone A. |
| Q: What is the molecular weight of Ochrocarpinone A? |
| A: Molecular weight of Ochrocarpinone A is 534.7. |
| Q: What is the molecular formula of Ochrocarpinone A? |
| A: Molecular formula of Ochrocarpinone A is C33H42O6. |
| Q: What is the InChIKey of Ochrocarpinone A? |
| A: InChIKey of Ochrocarpinone A is LCJOSIBQVUSWIH-UHFFFAOYSA-N. |