3-(4-chlorophenyl)-5-(2-methyl-3-furyl)-1,2,4-oxadiazole structure
|
Common Name | 3-(4-chlorophenyl)-5-(2-methyl-3-furyl)-1,2,4-oxadiazole | ||
|---|---|---|---|---|
| CAS Number | 4456-59-1 | Molecular Weight | 321.76600 | |
| Density | 1.301g/cm3 | Boiling Point | 396.4ºC at 760 mmHg | |
| Molecular Formula | C15H19ClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.5ºC | |
| Name | N-[2-chloro-5-(trifluoromethyl)phenyl]octanamide |
|---|
| Density | 1.301g/cm3 |
|---|---|
| Boiling Point | 396.4ºC at 760 mmHg |
| Molecular Formula | C15H19ClF3NO |
| Molecular Weight | 321.76600 |
| Flash Point | 193.5ºC |
| Exact Mass | 321.11100 |
| PSA | 29.10000 |
| LogP | 5.73080 |
| Index of Refraction | 1.572 |
| InChIKey | DCCPZTFQVSVVJP-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |