2-fluorophenylmagnesium bromide
2-fluorophenylmagnesium bromide structure
|
Common Name | 2-fluorophenylmagnesium bromide | ||
|---|---|---|---|---|
| CAS Number | 446-53-7 | Molecular Weight | 199.30300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4BrFMg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-fluorophenylmagnesium bromide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H4BrFMg |
|---|---|
| Molecular Weight | 199.30300 |
| Exact Mass | 197.93300 |
| LogP | 2.47150 |
| InChIKey | KZFNFSPJVPNKFT-UHFFFAOYSA-M |
| SMILES | Fc1[c-]cccc1.[Br-].[Mg+2] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:56446-74-3
CAS#:1000-46-0
CAS#:31616-44-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| fluorophenyl magnesium bromide |
| o-FC6H4MgBr |
| ortho-fluorophenyl magnesium bromide |
| 2-fluorophenyl magnesium bromide |
| o-fluorophenylmagnesium bromide |
| (2-fluoro-phenyl)-magnesium bromide |
| 2-Fluorophenylmagnesium Bromide (1M solution in THF) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 446-53-7? |
| A: Chinese name of 446-53-7 is 446-53-7. |
| Q: What English synonyms does 2-fluorophenylmagnesium bromide have? |
| A: English synonyms of 2-fluorophenylmagnesium bromide: fluorophenyl magnesium bromide, o-FC6H4MgBr, ortho-fluorophenyl magnesium bromide, 2-fluorophenyl magnesium bromide, o-fluorophenylmagnesium bromide, (2-fluoro-phenyl)-magnesium bromide, 2-Fluorophenylmagnesium Bromide (1M solution in THF). |
| Q: What is the InChIKey of 2-fluorophenylmagnesium bromide? |
| A: InChIKey of 2-fluorophenylmagnesium bromide is KZFNFSPJVPNKFT-UHFFFAOYSA-M. |
| Q: What are the downstream products of 2-fluorophenylmagnesium bromide? |
| A: Related downstream products(CAS) of 2-fluorophenylmagnesium bromide: 56446-74-3;1000-46-0;31616-44-1. |
| Q: What is the molecular weight of 2-fluorophenylmagnesium bromide? |
| A: Molecular weight of 2-fluorophenylmagnesium bromide is 199.30300. |
| Q: What is the English name of 2-fluorophenylmagnesium bromide? |
| A: The English name of 2-fluorophenylmagnesium bromide is 2-fluorophenylmagnesium bromide. |
| Q: What is the CAS number of 2-fluorophenylmagnesium bromide? |
| A: CAS number of 2-fluorophenylmagnesium bromide is 446-53-7. |
| Q: What is the molecular formula of 2-fluorophenylmagnesium bromide? |
| A: Molecular formula of 2-fluorophenylmagnesium bromide is C6H4BrFMg. |
| Q: What is the LogP of 2-fluorophenylmagnesium bromide? |
| A: LogP of 2-fluorophenylmagnesium bromide is 2.47150. |
| Q: What is the SMILES notation of 2-fluorophenylmagnesium bromide? |
| A: SMILES notation of 2-fluorophenylmagnesium bromide is Fc1[c-]cccc1.[Br-].[Mg+2]. |