5-Bromo-2-methoxy-4-nitropyridine structure
|
Common Name | 5-Bromo-2-methoxy-4-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 446284-18-0 | Molecular Weight | 233.01900 | |
| Density | 1.73g/cm3 | Boiling Point | 269.116ºC at 760 mmHg | |
| Molecular Formula | C6H5BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.558ºC | |
| Name | 5-Bromo-2-methoxy-4-nitropyridine |
|---|
| Density | 1.73g/cm3 |
|---|---|
| Boiling Point | 269.116ºC at 760 mmHg |
| Molecular Formula | C6H5BrN2O3 |
| Molecular Weight | 233.01900 |
| Flash Point | 116.558ºC |
| Exact Mass | 231.94800 |
| PSA | 67.94000 |
| LogP | 2.28410 |
| Index of Refraction | 1.587 |
| InChIKey | YJHNBGBOJWXMAG-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])c(Br)cn1 |
| HS Code | 2933399090 |
|---|
|
~%
5-Bromo-2-metho... CAS#:446284-18-0 |
| Literature: US2004/110785 A1, ; Page 76 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |