3-ethyl-7-nitro-1H-indole-2-carboxylic acid
Modify Date: 2026-04-19 11:01:18
3-ethyl-7-nitro-1H-indole-2-carboxylic acid structure
|
Common Name | 3-ethyl-7-nitro-1H-indole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 446830-64-4 | Molecular Weight | 234.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-ethyl-7-nitro-1H-indole-2-carboxylic acid |
|---|
| Molecular Formula | C11H10N2O4 |
|---|---|
| Molecular Weight | 234.21 |
| InChIKey | XBKSEZSINQHZPF-UHFFFAOYSA-N |
| SMILES | CCC1=C(NC2=C1C=CC=C2[N+](=O)[O-])C(=O)O |
|
Name: Inhibition of human recombinant FBPase expressed in Escherichia coli BL21(DE3) by pho...
Source: ChEMBL
Target: Fructose-1,6-bisphosphatase 1
External Id: CHEMBL3131191
|
Total 1, Current Page 1 of 1
1