2-Methoxyethyl 4-[(3-methylbenzoyl)amino]benzoate
Modify Date: 2026-07-01 13:38:19
![2-Methoxyethyl 4-[(3-methylbenzoyl)amino]benzoate Structure](https://www.chemsrc.com/extcaspic/317/446852-66-0.png)
2-Methoxyethyl 4-[(3-methylbenzoyl)amino]benzoate structure
|
Common Name | 2-Methoxyethyl 4-[(3-methylbenzoyl)amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 446852-66-0 | Molecular Weight | 313.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Methoxyethyl 4-[(3-methylbenzoyl)amino]benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H19NO4 |
|---|---|
| Molecular Weight | 313.3 |
| InChIKey | AKVWKPXUQMIOFH-UHFFFAOYSA-N |
| SMILES | COCCOC(=O)c1ccc(NC(=O)c2cccc(C)c2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-Methoxyethyl 4-[(3-methylbenzoyl)amino]benzoate? |
| A: CAS number of 2-Methoxyethyl 4-[(3-methylbenzoyl)amino]benzoate is 446852-66-0. |
| Q: What is the SMILES notation of 2-Methoxyethyl 4-[(3-methylbenzoyl)amino]benzoate? |
| A: SMILES notation of 2-Methoxyethyl 4-[(3-methylbenzoyl)amino]benzoate is COCCOC(=O)c1ccc(NC(=O)c2cccc(C)c2)cc1. |
| Q: What is the molecular weight of 2-Methoxyethyl 4-[(3-methylbenzoyl)amino]benzoate? |
| A: Molecular weight of 2-Methoxyethyl 4-[(3-methylbenzoyl)amino]benzoate is 313.3. |
| Q: What is the Chinese name of 446852-66-0? |
| A: Chinese name of 446852-66-0 is 446852-66-0. |
| Q: What is the molecular formula of 2-Methoxyethyl 4-[(3-methylbenzoyl)amino]benzoate? |
| A: Molecular formula of 2-Methoxyethyl 4-[(3-methylbenzoyl)amino]benzoate is C18H19NO4. |
| Q: What is the InChIKey of 2-Methoxyethyl 4-[(3-methylbenzoyl)amino]benzoate? |
| A: InChIKey of 2-Methoxyethyl 4-[(3-methylbenzoyl)amino]benzoate is AKVWKPXUQMIOFH-UHFFFAOYSA-N. |
| Q: What is the English name of 2-Methoxyethyl 4-[(3-methylbenzoyl)amino]benzoate? |
| A: The English name of 2-Methoxyethyl 4-[(3-methylbenzoyl)amino]benzoate is 2-Methoxyethyl 4-[(3-methylbenzoyl)amino]benzoate. |