dimethyl 2,2-dimethoxypentanedioate structure
|
Common Name | dimethyl 2,2-dimethoxypentanedioate | ||
|---|---|---|---|---|
| CAS Number | 4469-60-7 | Molecular Weight | 220.22000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 2,2-dimethoxypentanedioate |
|---|
| Molecular Formula | C9H16O6 |
|---|---|
| Molecular Weight | 220.22000 |
| Exact Mass | 220.09500 |
| PSA | 71.06000 |
| LogP | 0.10170 |
| InChIKey | DDOXYXADRPCSSN-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(OC)(OC)C(=O)OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |