Propanedioic acid,2-ethyl-2-(3-phenyl-2-propen-1-yl)- structure
|
Common Name | Propanedioic acid,2-ethyl-2-(3-phenyl-2-propen-1-yl)- | ||
|---|---|---|---|---|
| CAS Number | 4472-91-7 | Molecular Weight | 248.27400 | |
| Density | 1.227g/cm3 | Boiling Point | 487.5ºC at 760mmHg | |
| Molecular Formula | C14H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.7ºC | |
| Name | 2-ethyl-2-(3-phenylprop-2-enyl)propanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.227g/cm3 |
|---|---|
| Boiling Point | 487.5ºC at 760mmHg |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.27400 |
| Flash Point | 262.7ºC |
| Exact Mass | 248.10500 |
| PSA | 74.60000 |
| LogP | 2.65550 |
| Index of Refraction | 1.591 |
| InChIKey | HEYXYLGBRHTQRD-RMKNXTFCSA-N |
| SMILES | CCC(CC=Cc1ccccc1)(C(=O)O)C(=O)O |
| HS Code | 2917190090 |
|---|
|
~%
Propanedioic ac... CAS#:4472-91-7 |
| Literature: Blicke; Centolella Journal of the American Chemical Society, 1938 , vol. 60, p. 2923 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Aethyl-trans-cinnamyl-malonsaeure |
| Malonicacid,cinnamylethyl-(8CI) |
| Propanedioic acid,2-ethyl-2-(3-phenyl-2-propen-1-yl) |
| ethyl-trans-cinnamyl-malonic acid |
| 5-Hexene-3,3-dicarboxylic acid,6-phenyl |
| 2-CINNAMYL-2-ETHYL-PROPANEDIOIC ACID |