a-D-Galactopyranose,1,2:3,4-bis-O-(1-methylethylidene)-, 6-(4-methylbenzenesulfonate) structure
|
Common Name | a-D-Galactopyranose,1,2:3,4-bis-O-(1-methylethylidene)-, 6-(4-methylbenzenesulfonate) | ||
|---|---|---|---|---|
| CAS Number | 4478-43-7 | Molecular Weight | 414.47000 | |
| Density | 1.23 g/cm3 | Boiling Point | 513.7ºC at 760 mmHg | |
| Molecular Formula | C19H26O8S | Melting Point | 92°C(lit.) | |
| MSDS | N/A | Flash Point | 264.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.23 g/cm3 |
|---|---|
| Boiling Point | 513.7ºC at 760 mmHg |
| Melting Point | 92°C(lit.) |
| Molecular Formula | C19H26O8S |
| Molecular Weight | 414.47000 |
| Flash Point | 264.5ºC |
| Exact Mass | 414.13500 |
| PSA | 97.90000 |
| LogP | 3.17760 |
| Index of Refraction | 1.505 |
| InChIKey | CTGSZKNLORWSMQ-DRRXZNNHSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCC2OC3OC(C)(C)OC3C3OC(C)(C)OC23)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 9 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,2:3,4-Di-O-isopropylidene-6-O-p-toluenesulfonyl-a-D-galactose |
| 1,2:3,4-Di-O-isopropylidene-6-O-p-tolylsulfonyl-a-D-galactopyranose |
| 1,2:3,4-Di-O-isopropylidene-6-O-p-toluenesulfonyl-a-D-galactopyranose |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE? |
| A: Molecular formula of 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE is C19H26O8S. |
| Q: What English synonyms does 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE have? |
| A: English synonyms of 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE: 1,2:3,4-Di-O-isopropylidene-6-O-p-toluenesulfonyl-a-D-galactose, 1,2:3,4-Di-O-isopropylidene-6-O-p-tolylsulfonyl-a-D-galactopyranose, 1,2:3,4-Di-O-isopropylidene-6-O-p-toluenesulfonyl-a-D-galactopyranose. |
| Q: What is the LogP of 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE? |
| A: LogP of 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE is 3.17760. |
| Q: What is the melting point of 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE? |
| A: Melting point of 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE is 92°C(lit.). |
| Q: What is the boiling point of 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE? |
| A: Boiling point of 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE is 513.7ºC at 760 mmHg. |
| Q: What are the upstream materials of 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE? |
| A: Related upstream materials(CAS) of 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE: 98-59-9;4064-06-6;10257-28-0;6748-86-3;79378-77-1;59-23-4;67-64-1;34698-19-6;536-57-2;3646-73-9. |
| Q: What is the SMILES notation of 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE? |
| A: SMILES notation of 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE is Cc1ccc(S(=O)(=O)OCC2OC3OC(C)(C)OC3C3OC(C)(C)OC23)cc1. |
| Q: What is the polar surface area (PSA) of 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE? |
| A: Polar surface area (PSA) of 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE is 97.90000. |
| Q: What is the molecular weight of 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE? |
| A: Molecular weight of 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE is 414.47000. |
| Q: What is the CAS number of 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE? |
| A: CAS number of 1,2:3,4-DI-O-ISOPROPYLIDENE-6-O-P-TOLYLSULFONYL-α-D-GALACTOSE is 4478-43-7. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |