2-Methoxy-4-(trifluoromethyl)benzoic acid structure
|
Common Name | 2-Methoxy-4-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 448-36-2 | Molecular Weight | 220.14500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Methoxy-4-(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H7F3O3 |
|---|---|
| Molecular Weight | 220.14500 |
| Exact Mass | 220.03500 |
| PSA | 46.53000 |
| LogP | 2.41220 |
| InChIKey | QWRIRBUKLBWVNF-UHFFFAOYSA-N |
| SMILES | COc1cc(C(F)(F)F)ccc1C(=O)O |
| HS Code | 2918990090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-methoxy-4-(trifluoromethyl)benzoic acid |