2-[4-(4-chlorophenyl)piperazin-1-yl]ethyl (E)-3-(2-hydroxyphenyl)prop-2-enoate
Modify Date: 2025-08-25 12:18:08
![2-[4-(4-chlorophenyl)piperazin-1-yl]ethyl (E)-3-(2-hydroxyphenyl)prop-2-enoate Structure](https://image.chemsrc.com/caspic/000/4480-21-1.png)
2-[4-(4-chlorophenyl)piperazin-1-yl]ethyl (E)-3-(2-hydroxyphenyl)prop-2-enoate structure
|
Common Name | 2-[4-(4-chlorophenyl)piperazin-1-yl]ethyl (E)-3-(2-hydroxyphenyl)prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 4480-21-1 | Molecular Weight | 386.87200 | |
| Density | 1.263g/cm3 | Boiling Point | 578.1ºC at 760 mmHg | |
| Molecular Formula | C21H23ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.5ºC | |
| Name | 2-[4-(4-chlorophenyl)piperazin-1-yl]ethyl (E)-3-(2-hydroxyphenyl)prop-2-enoate |
|---|
| Density | 1.263g/cm3 |
|---|---|
| Boiling Point | 578.1ºC at 760 mmHg |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.87200 |
| Flash Point | 303.5ºC |
| Exact Mass | 386.14000 |
| PSA | 53.01000 |
| LogP | 3.42710 |
| Index of Refraction | 1.623 |
| InChIKey | QZODIIMGXUQTEB-BJMVGYQFSA-N |
| SMILES | O=C(C=Cc1ccccc1O)OCCN1CCN(c2ccc(Cl)cc2)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |