1-amino-3-[3-(trifluoromethyl)phenyl]urea structure
|
Common Name | 1-amino-3-[3-(trifluoromethyl)phenyl]urea | ||
|---|---|---|---|---|
| CAS Number | 448233-17-8 | Molecular Weight | 219.16400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8F3N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-amino-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8F3N3O |
|---|---|
| Molecular Weight | 219.16400 |
| Exact Mass | 219.06200 |
| PSA | 70.64000 |
| LogP | 2.80540 |
| InChIKey | KALJZHYDUIZASO-UHFFFAOYSA-N |
| SMILES | NNC(=O)Nc1cccc(C(F)(F)F)c1 |
| HS Code | 2928000090 |
|---|
|
~90%
1-amino-3-[3-(t... CAS#:448233-17-8 |
| Literature: Beukers, Margot W.; Wanner, Martin J.; Von Frijtag Drabbe Kuenzel, Jacobien K.; Klaasse, Elisabeth C.; IJzerman, Adriaan P.; Koomen, Gerrit-Jan Journal of Medicinal Chemistry, 2003 , vol. 46, # 8 p. 1492 - 1503 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N-[3-(trifluoromethyl)phenyl]-1-hydrazinecarboxamide |
| 4-(3-trifluoromethylphenyl)semicarbazide |
| [3-(trifluoromethyl)phenyl]amine |