1,3-diphenylpyrazole structure
|
Common Name | 1,3-diphenylpyrazole | ||
|---|---|---|---|---|
| CAS Number | 4492-01-7 | Molecular Weight | 220.26900 | |
| Density | 1.07g/cm3 | Boiling Point | 377ºC at 760 mmHg | |
| Molecular Formula | C15H12N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.8ºC | |
| Name | 1,3-diphenylpyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 377ºC at 760 mmHg |
| Molecular Formula | C15H12N2 |
| Molecular Weight | 220.26900 |
| Flash Point | 181.8ºC |
| Exact Mass | 220.10000 |
| PSA | 17.82000 |
| LogP | 3.53930 |
| Index of Refraction | 1.613 |
| InChIKey | LQUBXCVRJZGBLM-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2ccn(-c3ccccc3)n2)cc1 |
| HS Code | 2933199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyrazole,1,3-diphenyl |
| 1,3-Diphenyl-1H-pyrazole |