Ethyl 2-cyano-3,3-disulfanylprop-2-enoate
Modify Date: 2026-04-02 09:00:15
Ethyl 2-cyano-3,3-disulfanylprop-2-enoate structure
|
Common Name | Ethyl 2-cyano-3,3-disulfanylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 44975-54-4 | Molecular Weight | 187.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5NO2S2-2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 2-cyano-3,3-disulfanylprop-2-enoate |
|---|
| Molecular Formula | C6H5NO2S2-2 |
|---|---|
| Molecular Weight | 187.2 |
| InChIKey | WBROKGZRBHSRQF-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C(=C=[N-])C(=S)[S-] |
|
Name: Cell survival assay for modulators of telomere damage signalling
Source: 15378
Target: N/A
External Id: TELO_02
|
Total 1, Current Page 1 of 1
1