Ethyl 2-cyano-3,3-disulfanylprop-2-enoate
Modify Date: 2026-06-26 15:17:17
Ethyl 2-cyano-3,3-disulfanylprop-2-enoate structure
|
Common Name | Ethyl 2-cyano-3,3-disulfanylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 44975-54-4 | Molecular Weight | 187.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5NO2S2-2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 2-cyano-3,3-disulfanylprop-2-enoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H5NO2S2-2 |
|---|---|
| Molecular Weight | 187.2 |
| InChIKey | WBROKGZRBHSRQF-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C(=C=[N-])C(=S)[S-] |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Cell survival assay for modulators of telomere damage signalling
Source: 15378
Target: N/A
External Id: TELO_02
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Ethyl 2-cyano-3,3-disulfanylprop-2-enoate? |
| A: The English name of Ethyl 2-cyano-3,3-disulfanylprop-2-enoate is Ethyl 2-cyano-3,3-disulfanylprop-2-enoate. |
| Q: What is the molecular weight of Ethyl 2-cyano-3,3-disulfanylprop-2-enoate? |
| A: Molecular weight of Ethyl 2-cyano-3,3-disulfanylprop-2-enoate is 187.2. |
| Q: What is the molecular formula of Ethyl 2-cyano-3,3-disulfanylprop-2-enoate? |
| A: Molecular formula of Ethyl 2-cyano-3,3-disulfanylprop-2-enoate is C6H5NO2S2-2. |
| Q: What is the SMILES notation of Ethyl 2-cyano-3,3-disulfanylprop-2-enoate? |
| A: SMILES notation of Ethyl 2-cyano-3,3-disulfanylprop-2-enoate is CCOC(=O)C(=C=[N-])C(=S)[S-]. |
| Q: What is the Chinese name of 44975-54-4? |
| A: Chinese name of 44975-54-4 is 44975-54-4. |
| Q: What is the InChIKey of Ethyl 2-cyano-3,3-disulfanylprop-2-enoate? |
| A: InChIKey of Ethyl 2-cyano-3,3-disulfanylprop-2-enoate is WBROKGZRBHSRQF-UHFFFAOYSA-M. |
| Q: What is the CAS number of Ethyl 2-cyano-3,3-disulfanylprop-2-enoate? |
| A: CAS number of Ethyl 2-cyano-3,3-disulfanylprop-2-enoate is 44975-54-4. |