2-Propenoic acid,2-hydroxy-3-(1-naphthalenyloxy)propyl ester
Modify Date: 2026-07-18 20:26:10
2-Propenoic acid,2-hydroxy-3-(1-naphthalenyloxy)propyl ester structure
|
Common Name | 2-Propenoic acid,2-hydroxy-3-(1-naphthalenyloxy)propyl ester | ||
|---|---|---|---|---|
| CAS Number | 450360-84-6 | Molecular Weight | 272.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Propenoic acid,2-hydroxy-3-(1-naphthalenyloxy)propyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H16O4 |
|---|---|
| Molecular Weight | 272.29 |
| InChIKey | XZJYQTGBEXDXBU-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCC(O)COc1cccc2ccccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-Propenoic acid,2-hydroxy-3-(1-naphthalenyloxy)propyl ester? |
| A: CAS number of 2-Propenoic acid,2-hydroxy-3-(1-naphthalenyloxy)propyl ester is 450360-84-6. |
| Q: What is the Chinese name of 450360-84-6? |
| A: Chinese name of 450360-84-6 is 450360-84-6. |
| Q: What is the molecular weight of 2-Propenoic acid,2-hydroxy-3-(1-naphthalenyloxy)propyl ester? |
| A: Molecular weight of 2-Propenoic acid,2-hydroxy-3-(1-naphthalenyloxy)propyl ester is 272.29. |
| Q: What is the SMILES notation of 2-Propenoic acid,2-hydroxy-3-(1-naphthalenyloxy)propyl ester? |
| A: SMILES notation of 2-Propenoic acid,2-hydroxy-3-(1-naphthalenyloxy)propyl ester is C=CC(=O)OCC(O)COc1cccc2ccccc12. |
| Q: What is the English name of 2-Propenoic acid,2-hydroxy-3-(1-naphthalenyloxy)propyl ester? |
| A: The English name of 2-Propenoic acid,2-hydroxy-3-(1-naphthalenyloxy)propyl ester is 2-Propenoic acid,2-hydroxy-3-(1-naphthalenyloxy)propyl ester. |
| Q: What is the molecular formula of 2-Propenoic acid,2-hydroxy-3-(1-naphthalenyloxy)propyl ester? |
| A: Molecular formula of 2-Propenoic acid,2-hydroxy-3-(1-naphthalenyloxy)propyl ester is C16H16O4. |
| Q: What is the InChIKey of 2-Propenoic acid,2-hydroxy-3-(1-naphthalenyloxy)propyl ester? |
| A: InChIKey of 2-Propenoic acid,2-hydroxy-3-(1-naphthalenyloxy)propyl ester is XZJYQTGBEXDXBU-UHFFFAOYSA-N. |