4-(3-acetamidophenyl)butanoic acid structure
|
Common Name | 4-(3-acetamidophenyl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 4505-33-3 | Molecular Weight | 221.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3-acetamidophenyl)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15NO3 |
|---|---|
| Molecular Weight | 221.25200 |
| Exact Mass | 221.10500 |
| PSA | 66.40000 |
| LogP | 2.12530 |
| InChIKey | NRPQODVUAOZBSI-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cccc(CCCC(=O)O)c1 |
| HS Code | 2924299090 |
|---|
|
~%
4-(3-acetamidop... CAS#:4505-33-3 |
| Literature: Allinger,N.L.; Jones,E.S. Journal of Organic Chemistry, 1962 , vol. 27, p. 70 - 76 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-[3-(acetylamino)phenyl]butanoic acid |
| 4-(3-Acetamino-phenyl)-buttersaeure |