N-(difluoromethylideneamino)-1,1,1-trifluoro-N-(trifluoromethyl)methanamine structure
|
Common Name | N-(difluoromethylideneamino)-1,1,1-trifluoro-N-(trifluoromethyl)methanamine | ||
|---|---|---|---|---|
| CAS Number | 45082-85-7 | Molecular Weight | 216.03300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3F8N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(difluoromethylideneamino)-1,1,1-trifluoro-N-(trifluoromethyl)methanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C3F8N2 |
|---|---|
| Molecular Weight | 216.03300 |
| Exact Mass | 215.99300 |
| PSA | 15.60000 |
| LogP | 2.53800 |
| InChIKey | GTGIYMFHLCGIFU-UHFFFAOYSA-N |
| SMILES | FC(F)=NN(C(F)(F)F)C(F)(F)F |
|
~%
N-(difluorometh... CAS#:45082-85-7 |
| Literature: Dobbie,R.C.; Emeleus,H.J. Journal of the Chemical Society [Section] A: Inorganic, Physical, Theoretical, 1966 , p. 933 - 935 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Difluormethylendiazan |
| Bistrifluormethylamino-carbylaminfluorid |