2-methyl-2-(naphthalen-1-ylmethyl)propanedioic acid
Modify Date: 2025-09-18 11:07:06
2-methyl-2-(naphthalen-1-ylmethyl)propanedioic acid structure
|
Common Name | 2-methyl-2-(naphthalen-1-ylmethyl)propanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 4512-61-2 | Molecular Weight | 258.26900 | |
| Density | 1.323g/cm3 | Boiling Point | 474.4ºC at 760 mmHg | |
| Molecular Formula | C15H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.8ºC | |
| Name | 2-methyl-2-(naphthalen-1-ylmethyl)propanedioic acid |
|---|
| Density | 1.323g/cm3 |
|---|---|
| Boiling Point | 474.4ºC at 760 mmHg |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.26900 |
| Flash Point | 254.8ºC |
| Exact Mass | 258.08900 |
| PSA | 74.60000 |
| LogP | 2.55780 |
| Index of Refraction | 1.643 |
| InChIKey | LOOMLJQVFZAXDN-UHFFFAOYSA-N |
| SMILES | CC(Cc1cccc2ccccc12)(C(=O)O)C(=O)O |
| HS Code | 2917399090 |
|---|
|
~%
2-methyl-2-(nap... CAS#:4512-61-2 |
| Literature: Buchta,E.; Buchholz,S. Justus Liebigs Annalen der Chemie, 1965 , vol. 688, p. 40 - 53 |
|
~%
2-methyl-2-(nap... CAS#:4512-61-2 |
| Literature: Buchta,E.; Buchholz,S. Justus Liebigs Annalen der Chemie, 1965 , vol. 688, p. 40 - 53 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |