N,N-diethyl-2-methoxy-5-nitroaniline structure
|
Common Name | N,N-diethyl-2-methoxy-5-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 4513-19-3 | Molecular Weight | 224.25600 | |
| Density | 1.142g/cm3 | Boiling Point | 324.1ºC at 760mmHg | |
| Molecular Formula | C11H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.8ºC | |
| Name | N,N-diethyl-2-methoxy-5-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.142g/cm3 |
|---|---|
| Boiling Point | 324.1ºC at 760mmHg |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.25600 |
| Flash Point | 149.8ºC |
| Exact Mass | 224.11600 |
| PSA | 58.29000 |
| LogP | 2.97280 |
| Index of Refraction | 1.555 |
| InChIKey | VKWWGWYGBUWOOS-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1cc([N+](=O)[O-])ccc1OC |
| HS Code | 2922299090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzenamine,N,N-diethyl-2-methoxy-5-nitro |
| N,N-Diethylamino-2-methoxy-5-nitroanilin |