N-(4-chlorophenyl)sulfonylbenzenecarboximidoyl chloride
Modify Date: 2025-08-22 19:44:48
N-(4-chlorophenyl)sulfonylbenzenecarboximidoyl chloride structure
|
Common Name | N-(4-chlorophenyl)sulfonylbenzenecarboximidoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 4513-26-2 | Molecular Weight | 314.18700 | |
| Density | 1.375g/cm3 | Boiling Point | 448.557ºC at 760 mmHg | |
| Molecular Formula | C13H9Cl2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.079ºC | |
| Name | N-(4-chlorophenyl)sulfonylbenzenecarboximidoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.375g/cm3 |
|---|---|
| Boiling Point | 448.557ºC at 760 mmHg |
| Molecular Formula | C13H9Cl2NO2S |
| Molecular Weight | 314.18700 |
| Flash Point | 225.079ºC |
| Exact Mass | 312.97300 |
| PSA | 54.88000 |
| LogP | 4.79510 |
| Index of Refraction | 1.611 |
| InChIKey | JMSIBHGFTPRKEN-UHFFFAOYSA-N |
| SMILES | O=S(=O)(N=C(Cl)c1ccccc1)c1ccc(Cl)cc1 |
| HS Code | 2925290090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:14067-89-1
CAS#:833-50-1| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| N-<4-Chlor-benzol-sulfonyl>-benzimidchlorid |