Arsenobenzene structure
|
Common Name | Arsenobenzene | ||
|---|---|---|---|---|
| CAS Number | 4519-32-8 | Molecular Weight | 306.06700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12As2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Arsenobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12As2 |
|---|---|
| Molecular Weight | 306.06700 |
| Exact Mass | 305.93700 |
| LogP | 1.18580 |
| InChIKey | AWYSLGMLVOSVIS-UHFFFAOYSA-N |
| SMILES | c1ccc([As]=[As]c2ccccc2)cc1 |
| HS Code | 2931900090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1,2-Diphenyl-1,2-diarsaethene |
| Diphenyldiarsene |
| Arsenobenzol |
| diphenyldiarsenic acid |
| Einecs 224-845-1 |
| Arsenobisbenzene |