Sulfo-SPP sodium structure
|
Common Name | Sulfo-SPP sodium | ||
|---|---|---|---|---|
| CAS Number | 452072-24-1 | Molecular Weight | 442.46 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15N2NaO7S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Sulfo-SPP sodiumSulfo-SPP sodium a heterobifunctional, thiol-cleavable and membrane impermeable crosslinker. |
| Name | Sulfo-SPP sodium |
|---|
| Description | Sulfo-SPP sodium a heterobifunctional, thiol-cleavable and membrane impermeable crosslinker. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| Molecular Formula | C14H15N2NaO7S3 |
|---|---|
| Molecular Weight | 442.46 |
| InChIKey | BBEYHTSOUCPSMC-UHFFFAOYSA-M |
| SMILES | CC(CCC(=O)ON1C(=O)CC(S(=O)(=O)[O-])C1=O)SSc1ccccn1.[Na+] |