S-[2-[(Benzoyloxy)methyl]phenyl] benzenecarbothioate
Modify Date: 2025-11-06 20:10:50
![S-[2-[(Benzoyloxy)methyl]phenyl] benzenecarbothioate Structure](https://www.chemsrc.com/extcaspic/386/4521-29-3.png)
S-[2-[(Benzoyloxy)methyl]phenyl] benzenecarbothioate structure
|
Common Name | S-[2-[(Benzoyloxy)methyl]phenyl] benzenecarbothioate | ||
|---|---|---|---|---|
| CAS Number | 4521-29-3 | Molecular Weight | 348.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H16O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | S-[2-[(Benzoyloxy)methyl]phenyl] benzenecarbothioate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H16O3S |
|---|---|
| Molecular Weight | 348.4 |
| InChIKey | NMFAISLPCRKQQD-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1SC(=O)c1ccccc1)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of S-[2-[(Benzoyloxy)methyl]phenyl] benzenecarbothioate? |
| A: Molecular weight of S-[2-[(Benzoyloxy)methyl]phenyl] benzenecarbothioate is 348.4. |
| Q: What is the English name of S-[2-[(Benzoyloxy)methyl]phenyl] benzenecarbothioate? |
| A: The English name of S-[2-[(Benzoyloxy)methyl]phenyl] benzenecarbothioate is S-[2-[(Benzoyloxy)methyl]phenyl] benzenecarbothioate. |
| Q: What is the SMILES notation of S-[2-[(Benzoyloxy)methyl]phenyl] benzenecarbothioate? |
| A: SMILES notation of S-[2-[(Benzoyloxy)methyl]phenyl] benzenecarbothioate is O=C(OCc1ccccc1SC(=O)c1ccccc1)c1ccccc1. |
| Q: What is the Chinese name of 4521-29-3? |
| A: Chinese name of 4521-29-3 is 4521-29-3. |
| Q: What is the CAS number of S-[2-[(Benzoyloxy)methyl]phenyl] benzenecarbothioate? |
| A: CAS number of S-[2-[(Benzoyloxy)methyl]phenyl] benzenecarbothioate is 4521-29-3. |
| Q: What is the InChIKey of S-[2-[(Benzoyloxy)methyl]phenyl] benzenecarbothioate? |
| A: InChIKey of S-[2-[(Benzoyloxy)methyl]phenyl] benzenecarbothioate is NMFAISLPCRKQQD-UHFFFAOYSA-N. |
| Q: What is the molecular formula of S-[2-[(Benzoyloxy)methyl]phenyl] benzenecarbothioate? |
| A: Molecular formula of S-[2-[(Benzoyloxy)methyl]phenyl] benzenecarbothioate is C21H16O3S. |