propyl 4-[(3,5-dibromo-2-iodobenzoyl)amino]benzoate structure
|
Common Name | propyl 4-[(3,5-dibromo-2-iodobenzoyl)amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 4537-23-9 | Molecular Weight | 567.01000 | |
| Density | 1.93g/cm3 | Boiling Point | 506.5ºC at 760 mmHg | |
| Molecular Formula | C17H14Br2INO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.1ºC | |
| Name | propyl 4-[(3,5-dibromo-2-iodobenzoyl)amino]benzoate |
|---|
| Density | 1.93g/cm3 |
|---|---|
| Boiling Point | 506.5ºC at 760 mmHg |
| Molecular Formula | C17H14Br2INO3 |
| Molecular Weight | 567.01000 |
| Flash Point | 260.1ºC |
| Exact Mass | 564.83900 |
| PSA | 55.40000 |
| LogP | 5.70830 |
| Index of Refraction | 1.673 |
| InChIKey | BROIYMZDYYNLNC-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)c1ccc(NC(=O)c2cc(Br)cc(Br)c2I)cc1 |
|
~%
propyl 4-[(3,5-... CAS#:4537-23-9 |
| Literature: Lyons; Bush Journal of the American Chemical Society, 1908 , vol. 30, p. 834 |
|
~%
propyl 4-[(3,5-... CAS#:4537-23-9 |
| Literature: Lyons; Bush Journal of the American Chemical Society, 1908 , vol. 30, p. 834 |
|
~%
propyl 4-[(3,5-... CAS#:4537-23-9 |
| Literature: Rheinboldt; Petragnani Chemische Berichte, 1956 , vol. 89, p. 1270,1274 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |