2,2-bis(4-methoxyphenyl)acetic acid structure
|
Common Name | 2,2-bis(4-methoxyphenyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 4541-73-5 | Molecular Weight | 272.29600 | |
| Density | 1.19g/cm3 | Boiling Point | 431.1ºC at 760 mmHg | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.7ºC | |
| Name | 2,2-bis(4-methoxyphenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 431.1ºC at 760 mmHg |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.29600 |
| Flash Point | 158.7ºC |
| Exact Mass | 272.10500 |
| PSA | 55.76000 |
| LogP | 2.92030 |
| Index of Refraction | 1.57 |
| InChIKey | LZASYCDJCJCVCW-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(C(=O)O)c2ccc(OC)cc2)cc1 |
| HS Code | 2918990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,2-di-p-anisylacetic acid |
| 2,2-bis(p-methoxyphenyl)acetic acid |
| bis-(4-methoxyphenyl)acetic acid |