tert-butyl (4R)-4-methyl-2,2-dioxooxathiazolidine-3-carboxylate structure
|
Common Name | tert-butyl (4R)-4-methyl-2,2-dioxooxathiazolidine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 454248-53-4 | Molecular Weight | 237.27300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H15NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl (4R)-4-methyl-2,2-dioxooxathiazolidine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H15NO5S |
|---|---|
| Molecular Weight | 237.27300 |
| Exact Mass | 237.06700 |
| PSA | 81.29000 |
| LogP | 1.90570 |
| InChIKey | NFAKQWFVEAEEPG-ZCFIWIBFSA-N |
| SMILES | CC1COS(=O)(=O)N1C(=O)OC(C)(C)C |
| Storage condition | 2-8°C |
| HS Code | 2934100090 |
|---|
|
~%
tert-butyl (4R)... CAS#:454248-53-4 |
| Literature: Posakony, J. J.; Tewson, T. J. Journal of Labelled Compounds and Radiopharmaceuticals, 2001 , vol. 44, p. S925 - S926 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| (R)-4-Methyl-2,2-dioxo-2l6-[1,2,3]oxathiazolidine-3-carboxylic acid tert-butyl ester |
| (R)-methyl N-Boc sulfamidate |
| 3-(tert-butyloxycarbonyl)-(R)-4-methyl-1,2,3-oxathiazolidine 2,2-dioxide |
| TERT-BUTYL (R)-4-METHYL-2,2-DIOXO-[1,2,3]OXATHIAZOLIDINE-3-CARBOXYLATE |
| (R)-4-methyl-2,2-dioxo-[1,2,3] oxathiazolidine-3-carboxylic acid tert-butyl ester |
| tert butyl (R)-4-methyl 1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide |