benzophenone tosylhydrazone 97 structure
|
Common Name | benzophenone tosylhydrazone 97 | ||
|---|---|---|---|---|
| CAS Number | 4545-20-4 | Molecular Weight | 350.43400 | |
| Density | 1.17g/cm3 | Boiling Point | 514.1ºC at 760 mmHg | |
| Molecular Formula | C20H18N2O2S | Melting Point | 178-182ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 264.7ºC | |
| Name | N-(benzhydrylideneamino)-4-methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 514.1ºC at 760 mmHg |
| Melting Point | 178-182ºC(lit.) |
| Molecular Formula | C20H18N2O2S |
| Molecular Weight | 350.43400 |
| Flash Point | 264.7ºC |
| Exact Mass | 350.10900 |
| PSA | 66.91000 |
| LogP | 5.19760 |
| Index of Refraction | 1.606 |
| InChIKey | AVWHDUALELPLAI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NN=C(c2ccccc2)c2ccccc2)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2935009090 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| benzophenone p-toluenesulfonylhydrazone |
| N'-(diphenylmethylene)-4-methylbenzene-1-sulfonohydrazide |
| N'-(Diphenylmethylene)-4-methylbenzenesulfonohydrazide |
| benzophenone N-tosylhydrazone |
| diphenylmethylene tosylhydrazone |
| MFCD00381345 |
| Toluene-4-sulfonic acid benzhydrylidenehydrazone |
| Benzophenone p-tosylhydrazone |
| benzophenone 4-methylphenylsulfonylhydrazone |
| Benzophenone tosylhydrazone |