1H-Imidazole-1-ethanol,2-(4-fluorophenyl)-5-nitro- structure
|
Common Name | 1H-Imidazole-1-ethanol,2-(4-fluorophenyl)-5-nitro- | ||
|---|---|---|---|---|
| CAS Number | 4548-15-6 | Molecular Weight | 251.21400 | |
| Density | 1.44g/cm3 | Boiling Point | 466.1ºC at 760mmHg | |
| Molecular Formula | C11H10FN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.7ºC | |
| Name | 2-[2-(4-fluorophenyl)-5-nitroimidazol-1-yl]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 466.1ºC at 760mmHg |
| Molecular Formula | C11H10FN3O3 |
| Molecular Weight | 251.21400 |
| Flash Point | 235.7ºC |
| Exact Mass | 251.07100 |
| PSA | 83.87000 |
| LogP | 2.11290 |
| Index of Refraction | 1.626 |
| InChIKey | OQKHPZHGTCHGOQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cnc(-c2ccc(F)cc2)n1CCO |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(2'-Hydroxyethyl)-2-(p-fluorphenyl)-5-nitroimidazol |
| 2-[2-(4-fluoro-phenyl)-5-nitro-imidazol-1-yl]-ethanol |
| 1H-Imidazole-1-ethanol,2-(4-fluorophenyl)-5-nitro |
| 1-(2-hydroxyethyl)-2-(4-fluorophenyl)-5-nitroimidazole |
| Flunidazol |
| FLUNIDAZOLE |
| Imidazole-1-ethanol,2-(p-fluorophenyl)-5-nitro |
| 2-(4-Fluorphenyl)-1-(2-hydroxyethyl)-5-nitroimidazol |
| 2-(p-Fluorophenyl)-5-nitroimidazole-1-ethanol |
| 5-NI |
| 2-(p-fluorophenyl)-1-(2'-hydroxyethyl)-5-nitroimidazole |