6,6-bis(phenylmethoxy)hexane-1,2,3,4,5-pentol structure
|
Common Name | 6,6-bis(phenylmethoxy)hexane-1,2,3,4,5-pentol | ||
|---|---|---|---|---|
| CAS Number | 4550-94-1 | Molecular Weight | 378.41600 | |
| Density | 1.331g/cm3 | Boiling Point | 638.7ºC at 760 mmHg | |
| Molecular Formula | C20H26O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 340.1ºC | |
| Name | 6,6-bis(phenylmethoxy)hexane-1,2,3,4,5-pentol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.331g/cm3 |
|---|---|
| Boiling Point | 638.7ºC at 760 mmHg |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.41600 |
| Flash Point | 340.1ºC |
| Exact Mass | 378.16800 |
| PSA | 119.61000 |
| LogP | 0.18200 |
| Index of Refraction | 1.614 |
| InChIKey | YMTLBGVCGZMOLY-UHFFFAOYSA-N |
| SMILES | OCC(O)C(O)C(O)C(O)C(OCc1ccccc1)OCc1ccccc1 |
| HS Code | 2909499000 |
|---|
|
~%
6,6-bis(phenylm... CAS#:4550-94-1 |
| Literature: Wolfrom,M.L. et al. Journal of Organic Chemistry, 1965 , vol. 30, p. 2732 - 2735 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| D-Galactose-dibenzylacetal |