2-[bis(2-amino-2-hydroxyiminoethyl)amino]-N'-hydroxyethanimidamide structure
|
Common Name | 2-[bis(2-amino-2-hydroxyiminoethyl)amino]-N'-hydroxyethanimidamide | ||
|---|---|---|---|---|
| CAS Number | 4553-48-4 | Molecular Weight | 233.22800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H15N7O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[bis(2-amino-2-hydroxyiminoethyl)amino]-N'-hydroxyethanimidamide |
|---|
| Molecular Formula | C6H15N7O3 |
|---|---|
| Molecular Weight | 233.22800 |
| Exact Mass | 233.12400 |
| PSA | 171.57000 |
| InChIKey | ACSVUCQVEMONMS-UHFFFAOYSA-N |
| SMILES | NC(CN(CC(N)=NO)CC(N)=NO)=NO |
| HS Code | 2925290090 |
|---|
|
~%
2-[bis(2-amino-... CAS#:4553-48-4 |
| Literature: Barot,N.R.; Elvidge,J.A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1972 , p. 1009 - 1014 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |