2-(1-hydroxy-3,4-dioxo-naphthalen-2-yl)acetic acid structure
|
Common Name | 2-(1-hydroxy-3,4-dioxo-naphthalen-2-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 4554-99-8 | Molecular Weight | 232.18900 | |
| Density | 1.571g/cm3 | Boiling Point | 490.6ºC at 760 mmHg | |
| Molecular Formula | C12H8O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.6ºC | |
| Name | 2-(1-hydroxy-3,4-dioxonaphthalen-2-yl)acetic acid |
|---|
| Density | 1.571g/cm3 |
|---|---|
| Boiling Point | 490.6ºC at 760 mmHg |
| Molecular Formula | C12H8O5 |
| Molecular Weight | 232.18900 |
| Flash Point | 264.6ºC |
| Exact Mass | 232.03700 |
| PSA | 91.67000 |
| LogP | 1.35240 |
| Index of Refraction | 1.673 |
| InChIKey | GZXAJZYOXMILHM-UHFFFAOYSA-N |
| SMILES | O=C(O)CC1=C(O)c2ccccc2C(=O)C1=O |
| HS Code | 2918990090 |
|---|
|
~%
2-(1-hydroxy-3,... CAS#:4554-99-8 |
| Literature: Bamberger; Praetorius Monatshefte fuer Chemie, 1901 , vol. 22, p. 587 Monatshefte fuer Chemie, 1902 , vol. 23, p. 688 |
|
~%
2-(1-hydroxy-3,... CAS#:4554-99-8 |
| Literature: Liebermann Chemische Berichte, 1900 , vol. 33, p. 570 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |