trifluoromethanesulfonanilide structure
|
Common Name | trifluoromethanesulfonanilide | ||
|---|---|---|---|---|
| CAS Number | 456-64-4 | Molecular Weight | 225.18800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6F3NO2S | Melting Point | 67 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1-Trifluoro-N-phenylmethanesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 67 °C |
|---|---|
| Molecular Formula | C7H6F3NO2S |
| Molecular Weight | 225.18800 |
| Exact Mass | 225.00700 |
| PSA | 54.55000 |
| LogP | 3.10190 |
| Vapour Pressure | 0.0558mmHg at 25°C |
| InChIKey | OXDSKEQSEGDAFN-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Nc1ccccc1)C(F)(F)F |
| HS Code | 2935009090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Name: Discovery of Small Molecules to Inhibit Human Cytomegalovirus Nuclear Egress
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: HCMV UL50
External Id: HMS1262
|
|
Name: A screen for compounds that inhibit the activity of LtaS in Staphylococcus aureus
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
External Id: HMS979
|
|
Name: A screen for compounds that inhibit viral RNA polymerase binding and polymerization a...
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: Chain A, Poliovirus Polymerase With Gtp
External Id: HMS750
|
| N-Phenyl(trifluoromethane)sulfonamide |
| 1,1,1-trifluoro-N-phenylmethanesulfonamide |
| Trifluoromethanesulfonanilide |