N,N-bis(2-chloroethyl)-2-(1,3-dioxoisoindol-2-yl)acetamide structure
|
Common Name | N,N-bis(2-chloroethyl)-2-(1,3-dioxoisoindol-2-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 4561-07-3 | Molecular Weight | 329.17900 | |
| Density | 1.41g/cm3 | Boiling Point | 488.6ºC at 760 mmHg | |
| Molecular Formula | C14H14Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.3ºC | |
| Name | N,N-bis(2-chloroethyl)-2-(1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 488.6ºC at 760 mmHg |
| Molecular Formula | C14H14Cl2N2O3 |
| Molecular Weight | 329.17900 |
| Flash Point | 249.3ºC |
| Exact Mass | 328.03800 |
| PSA | 57.69000 |
| LogP | 1.52670 |
| Index of Refraction | 1.591 |
| InChIKey | RVFIKSKNEHOGEI-UHFFFAOYSA-N |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)N(CCCl)CCCl |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-Phthaloyl-glycin-bis-(2-chlorethyl)-amid |
| n,n-bis(2-chloroethyl)-2-(1,3-dioxo-1,3-dihydro-2h-isoindol-2-yl)acetamide |
| N-Phthalyl-glycin-<N,N-bis-(2-chlor-ethyl)-amid> |