1-methyl-4-vinylpyridin-1-ium
Modify Date: 2025-09-07 16:43:53
1-methyl-4-vinylpyridin-1-ium structure
|
Common Name | 1-methyl-4-vinylpyridin-1-ium | ||
|---|---|---|---|---|
| CAS Number | 45708-68-7 | Molecular Weight | 120.17200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10N+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-methyl-4-vinylpyridin-1-ium |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H10N+ |
|---|---|
| Molecular Weight | 120.17200 |
| Exact Mass | 120.08100 |
| PSA | 3.88000 |
| LogP | 1.15410 |
| InChIKey | HPNLXNXDMUZRCG-UHFFFAOYSA-M |
| SMILES | C=Cc1cc[n+](C)cc1.O=S(=O)([O-])C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-methyl-4-vinylpyridin-1-ium? |
| A: Molecular formula of 1-methyl-4-vinylpyridin-1-ium is C8H10N+. |
| Q: What is the English name of 1-methyl-4-vinylpyridin-1-ium? |
| A: The English name of 1-methyl-4-vinylpyridin-1-ium is 1-methyl-4-vinylpyridin-1-ium. |
| Q: What is the SMILES notation of 1-methyl-4-vinylpyridin-1-ium? |
| A: SMILES notation of 1-methyl-4-vinylpyridin-1-ium is C=Cc1cc[n+](C)cc1.O=S(=O)([O-])C(F)(F)F. |
| Q: What is the molecular weight of 1-methyl-4-vinylpyridin-1-ium? |
| A: Molecular weight of 1-methyl-4-vinylpyridin-1-ium is 120.17200. |
| Q: What is the LogP of 1-methyl-4-vinylpyridin-1-ium? |
| A: LogP of 1-methyl-4-vinylpyridin-1-ium is 1.15410. |
| Q: What is the InChIKey of 1-methyl-4-vinylpyridin-1-ium? |
| A: InChIKey of 1-methyl-4-vinylpyridin-1-ium is HPNLXNXDMUZRCG-UHFFFAOYSA-M. |
| Q: What is the polar surface area (PSA) of 1-methyl-4-vinylpyridin-1-ium? |
| A: Polar surface area (PSA) of 1-methyl-4-vinylpyridin-1-ium is 3.88000. |
| Q: What is the CAS number of 1-methyl-4-vinylpyridin-1-ium? |
| A: CAS number of 1-methyl-4-vinylpyridin-1-ium is 45708-68-7. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |