3-(1,4-dioxo-3H-phthalazin-2-yl)propanoic acid structure
|
Common Name | 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 4572-80-9 | Molecular Weight | 234.20800 | |
| Density | 1.418g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(1,4-dioxo-3H-phthalazin-2-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.418g/cm3 |
|---|---|
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.20800 |
| Exact Mass | 234.06400 |
| PSA | 92.42000 |
| LogP | 0.57680 |
| Index of Refraction | 1.6 |
| InChIKey | QAUAVUXZOYSZHE-UHFFFAOYSA-N |
| SMILES | O=C(O)CCn1[nH]c(=O)c2ccccc2c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-<2-Carboxy-ethyl>-2.3-dihydro-phthalazin-1.4-dion |