Cyclic ala-phe-ile-gly-leu-met
Modify Date: 2025-09-07 12:44:47
Cyclic ala-phe-ile-gly-leu-met structure
|
Common Name | Cyclic ala-phe-ile-gly-leu-met | ||
|---|---|---|---|---|
| CAS Number | 4575-63-7 | Molecular Weight | 649.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H51N7O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Cyclic ala-phe-ile-gly-leu-met |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C31H51N7O6S |
|---|---|
| Molecular Weight | 649.8 |
| InChIKey | JROGBIAERYBANY-SQOGFUTRSA-N |
| SMILES | CCC(C)C(NC(=O)C(Cc1ccccc1)NC(=O)C(C)N)C(=O)NCC(=O)NC(CC(C)C)C(=O)NC(CCSC)C(N)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Cyclic ala-phe-ile-gly-leu-met? |
| A: CAS number of Cyclic ala-phe-ile-gly-leu-met is 4575-63-7. |
| Q: What is the English name of Cyclic ala-phe-ile-gly-leu-met? |
| A: The English name of Cyclic ala-phe-ile-gly-leu-met is Cyclic ala-phe-ile-gly-leu-met. |
| Q: What is the molecular formula of Cyclic ala-phe-ile-gly-leu-met? |
| A: Molecular formula of Cyclic ala-phe-ile-gly-leu-met is C31H51N7O6S. |
| Q: What is the SMILES notation of Cyclic ala-phe-ile-gly-leu-met? |
| A: SMILES notation of Cyclic ala-phe-ile-gly-leu-met is CCC(C)C(NC(=O)C(Cc1ccccc1)NC(=O)C(C)N)C(=O)NCC(=O)NC(CC(C)C)C(=O)NC(CCSC)C(N)=O. |
| Q: What is the InChIKey of Cyclic ala-phe-ile-gly-leu-met? |
| A: InChIKey of Cyclic ala-phe-ile-gly-leu-met is JROGBIAERYBANY-SQOGFUTRSA-N. |
| Q: What is the Chinese name of 4575-63-7? |
| A: Chinese name of 4575-63-7 is 4575-63-7. |
| Q: What is the molecular weight of Cyclic ala-phe-ile-gly-leu-met? |
| A: Molecular weight of Cyclic ala-phe-ile-gly-leu-met is 649.8. |