2-(1,1-Dimethylethyl)-4-(1-methylethylidene)cyclobutanone
Modify Date: 2026-09-27 15:32:24
2-(1,1-Dimethylethyl)-4-(1-methylethylidene)cyclobutanone structure
|
Common Name | 2-(1,1-Dimethylethyl)-4-(1-methylethylidene)cyclobutanone | ||
|---|---|---|---|---|
| CAS Number | 4579-32-2 | Molecular Weight | 166.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(1,1-Dimethylethyl)-4-(1-methylethylidene)cyclobutanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H18O |
|---|---|
| Molecular Weight | 166.26 |
| InChIKey | LQXSEZZDGPLEAL-UHFFFAOYSA-N |
| SMILES | CC(C)=C1CC(C(C)(C)C)C1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-(1,1-Dimethylethyl)-4-(1-methylethylidene)cyclobutanone? |
| A: The English name of 2-(1,1-Dimethylethyl)-4-(1-methylethylidene)cyclobutanone is 2-(1,1-Dimethylethyl)-4-(1-methylethylidene)cyclobutanone. |
| Q: What is the molecular formula of 2-(1,1-Dimethylethyl)-4-(1-methylethylidene)cyclobutanone? |
| A: Molecular formula of 2-(1,1-Dimethylethyl)-4-(1-methylethylidene)cyclobutanone is C11H18O. |
| Q: What is the Chinese name of 4579-32-2? |
| A: Chinese name of 4579-32-2 is 4579-32-2. |
| Q: What is the molecular weight of 2-(1,1-Dimethylethyl)-4-(1-methylethylidene)cyclobutanone? |
| A: Molecular weight of 2-(1,1-Dimethylethyl)-4-(1-methylethylidene)cyclobutanone is 166.26. |
| Q: What is the CAS number of 2-(1,1-Dimethylethyl)-4-(1-methylethylidene)cyclobutanone? |
| A: CAS number of 2-(1,1-Dimethylethyl)-4-(1-methylethylidene)cyclobutanone is 4579-32-2. |
| Q: What is the SMILES notation of 2-(1,1-Dimethylethyl)-4-(1-methylethylidene)cyclobutanone? |
| A: SMILES notation of 2-(1,1-Dimethylethyl)-4-(1-methylethylidene)cyclobutanone is CC(C)=C1CC(C(C)(C)C)C1=O. |
| Q: What is the InChIKey of 2-(1,1-Dimethylethyl)-4-(1-methylethylidene)cyclobutanone? |
| A: InChIKey of 2-(1,1-Dimethylethyl)-4-(1-methylethylidene)cyclobutanone is LQXSEZZDGPLEAL-UHFFFAOYSA-N. |