5-[(4-chlorophenoxy)methyl]-5-methylimidazolidine-2,4-dione
Modify Date: 2025-09-20 18:49:47
![5-[(4-chlorophenoxy)methyl]-5-methylimidazolidine-2,4-dione Structure](https://image.chemsrc.com/caspic/076/4579-59-3.png)
5-[(4-chlorophenoxy)methyl]-5-methylimidazolidine-2,4-dione structure
|
Common Name | 5-[(4-chlorophenoxy)methyl]-5-methylimidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 4579-59-3 | Molecular Weight | 254.67000 | |
| Density | 1.315g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H11ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(4-chlorophenoxy)methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.315g/cm3 |
|---|---|
| Molecular Formula | C11H11ClN2O3 |
| Molecular Weight | 254.67000 |
| Exact Mass | 254.04600 |
| PSA | 74.41000 |
| LogP | 1.23280 |
| Index of Refraction | 1.545 |
| InChIKey | CEAUHZXBQOVWSY-UHFFFAOYSA-N |
| SMILES | CC1(COc2ccc(Cl)cc2)NC(=O)NC1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| p-Chlorophenoxymethyl-5 methyl-4 hydantoine |