2H-Benzimidazol-2-one,1,3-dihydro-5-methoxy-1-methyl-(9CI) structure
|
Common Name | 2H-Benzimidazol-2-one,1,3-dihydro-5-methoxy-1-methyl-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 4583-86-2 | Molecular Weight | 178.188 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methoxy-3-methyl-1H-benzimidazol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.188 |
| Exact Mass | 178.074234 |
| PSA | 47.28000 |
| LogP | 1.12 |
| Index of Refraction | 1.566 |
| InChIKey | ZFMIDGIWKKDSTH-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)[nH]c(=O)n2C |
| HS Code | 2933990090 |
|---|
|
~44%
2H-Benzimidazol... CAS#:4583-86-2 |
| Literature: Boehringer Ingelheim International GmbH Patent: US2007/203125 A1, 2007 ; Location in patent: Page/Page column 36 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Methoxy-1-methyl-1,3-dihydro-2H-benzimidazol-2-one |
| 5-Methoxy-1-methyl-benzimidazolinon-(2) |
| QC-4158 |
| 5-methoxy-1-methyl-1,3-dihydro-benzimidazol-2-one |
| 5-methoxy-1-methyl-1,3-dihydro-benzoimidazol-2-one |
| 5-methoxy-1-methyl-1H-benzo[d]imidazol-2(3H)-one |
| 1-Methyl-5-methoxybenzimidazolon |
| 2H-Benzimidazol-2-one,1,3-dihydro-5-methoxy-1-methyl-(9CI) |