4-[(2-hydroxyphenyl)methylidene]-1-phenyl-pyrazolidine-3,5-dione structure
|
Common Name | 4-[(2-hydroxyphenyl)methylidene]-1-phenyl-pyrazolidine-3,5-dione | ||
|---|---|---|---|---|
| CAS Number | 4590-83-4 | Molecular Weight | 280.27800 | |
| Density | 1.406g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4Z)-4-[(2-hydroxyphenyl)methylidene]-1-phenylpyrazolidine-3,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.406g/cm3 |
|---|---|
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.27800 |
| Exact Mass | 280.08500 |
| PSA | 73.13000 |
| LogP | 2.19450 |
| Index of Refraction | 1.711 |
| InChIKey | CAAFDHKQRXOTLT-RAXLEYEMSA-N |
| SMILES | O=C1NN(c2ccccc2)C(=O)C1=Cc1ccccc1O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(2-Hydroxy-benzyliden)-1-phenyl-pyrazolidin-dion-3.5 |
| 4-(2-hydroxy-benzylidene)-1-phenyl-pyrazolidine-3,5-dione |
| 1-Phenyl-4-salicyliden-pyrazolidin-3,5-dion |
| 4-[(2-hydroxyphenyl)methylene]-1-phenyl-1,2-diazolidine-3,5-dione |
| 1-phenyl-4-salicylidene-pyrazolidine-3,5-dione |