2,3-Bis(4-chlorophenyl)-2-butenedinitrile
Modify Date: 2025-09-08 18:48:36
2,3-Bis(4-chlorophenyl)-2-butenedinitrile structure
|
Common Name | 2,3-Bis(4-chlorophenyl)-2-butenedinitrile | ||
|---|---|---|---|---|
| CAS Number | 4591-17-7 | Molecular Weight | 299.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H8Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-Bis(4-chlorophenyl)-2-butenedinitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H8Cl2N2 |
|---|---|
| Molecular Weight | 299.2 |
| InChIKey | JUYWCUVBBRWOOO-NXVVXOECSA-N |
| SMILES | N#CC(=C(C#N)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,3-Bis(4-chlorophenyl)-2-butenedinitrile? |
| A: InChIKey of 2,3-Bis(4-chlorophenyl)-2-butenedinitrile is JUYWCUVBBRWOOO-NXVVXOECSA-N. |
| Q: What is the CAS number of 2,3-Bis(4-chlorophenyl)-2-butenedinitrile? |
| A: CAS number of 2,3-Bis(4-chlorophenyl)-2-butenedinitrile is 4591-17-7. |
| Q: What is the English name of 2,3-Bis(4-chlorophenyl)-2-butenedinitrile? |
| A: The English name of 2,3-Bis(4-chlorophenyl)-2-butenedinitrile is 2,3-Bis(4-chlorophenyl)-2-butenedinitrile. |
| Q: What is the molecular weight of 2,3-Bis(4-chlorophenyl)-2-butenedinitrile? |
| A: Molecular weight of 2,3-Bis(4-chlorophenyl)-2-butenedinitrile is 299.2. |
| Q: What is the SMILES notation of 2,3-Bis(4-chlorophenyl)-2-butenedinitrile? |
| A: SMILES notation of 2,3-Bis(4-chlorophenyl)-2-butenedinitrile is N#CC(=C(C#N)c1ccc(Cl)cc1)c1ccc(Cl)cc1. |
| Q: What is the Chinese name of 4591-17-7? |
| A: Chinese name of 4591-17-7 is 4591-17-7. |
| Q: What is the molecular formula of 2,3-Bis(4-chlorophenyl)-2-butenedinitrile? |
| A: Molecular formula of 2,3-Bis(4-chlorophenyl)-2-butenedinitrile is C16H8Cl2N2. |