(1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide
Modify Date: 2026-08-14 16:50:15
![(1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide Structure](https://image.chemsrc.com/caspic/152/459124-75-5.png)
(1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide structure
|
Common Name | (1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 459124-75-5 | Molecular Weight | 197.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H15NO3 |
|---|---|
| Molecular Weight | 197.23100 |
| Exact Mass | 197.10500 |
| PSA | 66.40000 |
| LogP | 1.27810 |
| InChIKey | JVJGVVLLVCSDOM-LDWIPMOCSA-N |
| SMILES | CC1(C)C2CCC1(C(=O)NO)C(=O)C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide? |
| A: CAS number of (1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide is 459124-75-5. |
| Q: What is the Chinese name of 459124-75-5? |
| A: Chinese name of 459124-75-5 is 459124-75-5. |
| Q: What is the SMILES notation of (1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide? |
| A: SMILES notation of (1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide is CC1(C)C2CCC1(C(=O)NO)C(=O)C2. |
| Q: What is the English name of (1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide? |
| A: The English name of (1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide is (1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide. |
| Q: What is the polar surface area (PSA) of (1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide? |
| A: Polar surface area (PSA) of (1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide is 66.40000. |
| Q: What is the InChIKey of (1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide? |
| A: InChIKey of (1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide is JVJGVVLLVCSDOM-LDWIPMOCSA-N. |
| Q: What is the molecular formula of (1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide? |
| A: Molecular formula of (1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide is C10H15NO3. |
| Q: What is the LogP of (1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide? |
| A: LogP of (1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide is 1.27810. |
| Q: What is the molecular weight of (1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide? |
| A: Molecular weight of (1S,4R)-N-hydroxy-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide is 197.23100. |