3-methyl-4-nitro-1,2-thiazole-5-carboxylic acid structure
|
Common Name | 3-methyl-4-nitro-1,2-thiazole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 4592-53-4 | Molecular Weight | 188.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H4N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-4-nitro-1,2-thiazole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5H4N2O4S |
|---|---|
| Molecular Weight | 188.16100 |
| Exact Mass | 187.98900 |
| PSA | 124.25000 |
| LogP | 1.58110 |
| InChIKey | JNGIXAWRDOXWOV-UHFFFAOYSA-N |
| SMILES | Cc1nsc(C(=O)O)c1[N+](=O)[O-] |
| HS Code | 2934999090 |
|---|
|
~%
3-methyl-4-nitr... CAS#:4592-53-4 |
| Literature: Holland,A. et al. Journal of the Chemical Society, 1965 , p. 7277 - 7282 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Isothiazolecarboxylicacid,3-methyl-4-nitro |
| 3-methyl-4-nitro-isothiazole-5-carboxylic acid |
| 3-Methyl-4-nitro-isothiazol-5-carbonsaeure |