tetra(propan-2-yl)germane structure
|
Common Name | tetra(propan-2-yl)germane | ||
|---|---|---|---|---|
| CAS Number | 4593-82-2 | Molecular Weight | 244.99100 | |
| Density | N/A | Boiling Point | 230.8ºC at 760mmHg | |
| Molecular Formula | C12H28Ge | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tetra(propan-2-yl)germane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 230.8ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H28Ge |
| Molecular Weight | 244.99100 |
| Exact Mass | 246.14000 |
| LogP | 5.07520 |
| InChIKey | VIOZOELPIXYDFS-UHFFFAOYSA-N |
| SMILES | CC(C)[Ge](C(C)C)(C(C)C)C(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Tetraisopropyl germane |
| Germanium,tetraisopropyl |
| tetrapropan-2-ylgermane |
| Tetraisopropylgerman |