N-[(3,4-Dimethylphenyl)sulfonyl]-β-alanine
Modify Date: 2025-08-20 08:11:08
![N-[(3,4-Dimethylphenyl)sulfonyl]-β-alanine Structure](https://image.chemsrc.com/caspic/302/459414-01-8.png)
N-[(3,4-Dimethylphenyl)sulfonyl]-β-alanine structure
|
Common Name | N-[(3,4-Dimethylphenyl)sulfonyl]-β-alanine | ||
|---|---|---|---|---|
| CAS Number | 459414-01-8 | Molecular Weight | 257.306 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 464.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C11H15NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.6±31.5 °C | |
Use of N-[(3,4-Dimethylphenyl)sulfonyl]-β-alanineN-[(3,4-Dimethylphenyl)sulfonyl]-beta-alanine is a derivative of alanine and can be used research chemical for a range of applications. |
| Name | N-[(3,4-Dimethylphenyl)sulfonyl]-β-alanine |
|---|---|
| Synonym | More Synonyms |
| Description | N-[(3,4-Dimethylphenyl)sulfonyl]-beta-alanine is a derivative of alanine and can be used research chemical for a range of applications. |
|---|---|
| Related Catalog |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 464.4±55.0 °C at 760 mmHg |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.306 |
| Flash Point | 234.6±31.5 °C |
| Exact Mass | 257.072174 |
| LogP | 1.70 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | IQVMYGSVWQCJFR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(=O)O)cc1C |
| MFCD02361180 |
| β-Alanine, N-[(3,4-dimethylphenyl)sulfonyl]- |
| N-[(3,4-Dimethylphenyl)sulfonyl]-β-alanine |
| 3-(3,4-Dimethyl-benzenesulfonylamino)-propionic acid |