2-chloro-1,1,2-trifluoro-1-(trichloromethoxy)ethane structure
|
Common Name | 2-chloro-1,1,2-trifluoro-1-(trichloromethoxy)ethane | ||
|---|---|---|---|---|
| CAS Number | 460-99-1 | Molecular Weight | 251.84700 | |
| Density | 1.715g/cm3 | Boiling Point | 171.1ºC at 760mmHg | |
| Molecular Formula | C3HCl4F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 57.3ºC | |
| Name | 2-chloro-1,1,2-trifluoro-1-(trichloromethoxy)ethane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.715g/cm3 |
|---|---|
| Boiling Point | 171.1ºC at 760mmHg |
| Molecular Formula | C3HCl4F3O |
| Molecular Weight | 251.84700 |
| Flash Point | 57.3ºC |
| Exact Mass | 249.87300 |
| PSA | 9.23000 |
| LogP | 3.45790 |
| Vapour Pressure | 1.89mmHg at 25°C |
| Index of Refraction | 1.424 |
| InChIKey | LSAUFTHJJZPNMH-UHFFFAOYSA-N |
| SMILES | FC(Cl)C(F)(F)OC(Cl)(Cl)Cl |
| HS Code | 2909199090 |
|---|
| HS Code | 2909199090 |
|---|---|
| Summary | 2909199090. other acyclic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2-Chlor-1,1,2-trifluor-1-trichlormethoxy-aethan |
| 2-chloro-1,1,2-trifluoroethyl trichloromethyl ether |
| EINECS 207-308-6 |