1H-1,3,2-Benzodiazaphosphole,2,3-dihydro-4,6-dimethyl-2-phenyl-, 2-sulfide structure
|
Common Name | 1H-1,3,2-Benzodiazaphosphole,2,3-dihydro-4,6-dimethyl-2-phenyl-, 2-sulfide | ||
|---|---|---|---|---|
| CAS Number | 4600-23-1 | Molecular Weight | 274.32100 | |
| Density | 1.29g/cm3 | Boiling Point | 410.4ºC at 760 mmHg | |
| Molecular Formula | C14H15N2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202ºC | |
| Name | 4,6-dimethyl-2-phenyl-2-sulfanylidene-1,3-dihydro-1,3,2λ5-benzodiazaphosphole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 410.4ºC at 760 mmHg |
| Molecular Formula | C14H15N2PS |
| Molecular Weight | 274.32100 |
| Flash Point | 202ºC |
| Exact Mass | 274.06900 |
| PSA | 65.96000 |
| LogP | 4.70240 |
| Index of Refraction | 1.673 |
| InChIKey | SLASJVJQLPSPHV-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c2c(c1)NP(=S)(c1ccccc1)N2 |
| HS Code | 2934999090 |
|---|
|
~%
1H-1,3,2-Benzod... CAS#:4600-23-1 |
| Literature: Dannley,R.L.; Grava,A. Canadian Journal of Chemistry, 1965 , vol. 43, p. 3377 - 3386 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,6-Dimethyl-2-phenyl-2,3-dihydro-1H-1,3,2-benzodiazaphosphole 2-sulfide |
| 4,6-Dimethyl-2-phenyl-2,3-dihydro-1H-1,3,2-benzodiaza-phosphol-2-sulfid |
| HMS3085I24 |