9-methyl-8-phenyl-8-sulfanylidene-7,9-diaza-8$l^C13H13N2PS-phosphabicyclo[4.3.0]nona-1,3,5-triene structure
|
Common Name | 9-methyl-8-phenyl-8-sulfanylidene-7,9-diaza-8$l^C13H13N2PS-phosphabicyclo[4.3.0]nona-1,3,5-triene | ||
|---|---|---|---|---|
| CAS Number | 4600-27-5 | Molecular Weight | 260.29400 | |
| Density | 1.32g/cm3 | Boiling Point | 394ºC at 760 mmHg | |
| Molecular Formula | C13H13N2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.1ºC | |
| Name | 3-methyl-2-phenyl-2-sulfanylidene-1H-1,3,2λ5-benzodiazaphosphole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 394ºC at 760 mmHg |
| Molecular Formula | C13H13N2PS |
| Molecular Weight | 260.29400 |
| Flash Point | 192.1ºC |
| Exact Mass | 260.05400 |
| PSA | 57.17000 |
| LogP | 4.03690 |
| Index of Refraction | 1.695 |
| InChIKey | DUAHSZCHXYSRMA-UHFFFAOYSA-N |
| SMILES | CN1c2ccccc2NP1(=S)c1ccccc1 |
|
~%
9-methyl-8-phen... CAS#:4600-27-5 |
| Literature: Anisimova,O.S. et al. J. Gen. Chem. USSR (Engl. Transl.), 1976 , vol. 46, p. 808 - 813,807 - 811 |
|
~%
9-methyl-8-phen... CAS#:4600-27-5 |
| Literature: Dannley,R.L.; Grava,A. Canadian Journal of Chemistry, 1965 , vol. 43, p. 3377 - 3386 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-methyl-2-phenyl-2,3-dihydro-1H-1,3,2-benzodiazaphosphole 2-sulfide |
| 1-Methyl-2-phenyl-2,3-dihydro-1H-1,3,2-benzodiaza-phosphol-2-sulfid |
| 3-methyl-2-phenyl-2-sulfanylidene-1H-1,3,2 |